Bergaptene

5-MethoxypsoralenBergapteneHeraclinMajudin 484-20-8 Interactive image CHEBI:18293 ChEMBL24171 2265 207-604-5 D07521 2355 4FVK84C92X DTXSID1025560 InChI=1S/C12H8O4/c1-14-12-7-2-3-11(13)16-10(7)6-9-8(12)4-5-15-9/h2-6H,1H3Key: BGEBZHIAGXMEMV-UHFFFAOYSA-N COC1=C2C=CC(=O)OC2=CC3=C1C=CO3 Bergapten(5-methoxypsoralen) is a naturally occurring organic chemical compound produced by numerous plant species, especially from the carrot familyApiaceaeand the citrus familyRutaceae.​​​‍​​‍​​​​‍​​‍‍ For example, bergapten has been extracted from 24 species of the genusHeracleumin the family Apiaceae.In the family Rutaceae, variousCitrusspecies contain significant amounts of bergapten,especially thebergamot orange, themicrantha, and certain varieties oflimeandbitter orange. Bergapten belongs to a class of chemical compounds known as thefuranocoumarins. In 1834, Kalbrunner isolated 5-methoxypsoralen frombergamot essential oil,hence the common name "bergapten". It was the first furanocoumarin to be isolated and identified.