Veliparib

L01XK05(WHO) 2-((R)-2-Methylpyrrolidin-2-yl)-1H-benzimidazole-4-carboxamide 912444-00-9Y 11960529 7417 DB07232N 10134775N 01O4K0631N D09692 ChEMBL506871N DTXSID90238456 Interactive image C[C@]3(c2nc1c(C(N)=O)cccc1[nH]2)CCCN3 InChI=1S/C13H16N4O/c1-13(6-3-7-15-13)12-16-9-5-2-4-8(11(14)18)10(9)17-12/h2,4-5,15H,3,6-7H2,1H3,(H2,14,18)(H,16,17)/t13-/m1/s1NKey:JNAHVYVRKWKWKQ-CYBMUJFWSA-NN Veliparib(ABT-888)is a potential anti-cancer drug acting as aPARP inhibitor. It kills cancer cells by blocking a protein called PARP, thereby preventing the repair of DNA or genetic damage in cancer cells and possibly making them more susceptible to anticancer treatments. Veliparib may make whole brain radiation treatment work more effectively against brain metastases from NSCLC. It has been shown to potentiate the effects of many chemotherapeutics, and as such has been part of many combination clinical trials. It inhibits bothPARP1andPARP2and thereby induces synthetic lethality. It is still being evaluated for the treatment ofovarian cancer.